C14H23FIN3 — CID 111128366
1-[(3-fluorophenyl)methyl]-2-methyl-3-pentylguanidine;hydroiodide (PubChem CID 111128366) has the molecular formula C14H23FIN3 and a molecular weight of 379.26 g/mol. Its IUPAC name is 1-[(3-fluorophenyl)methyl]-2-methyl-3-pentylguanidine;hydroiodide.
| Compound Name | 1-[(3-fluorophenyl)methyl]-2-methyl-3-pentylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111128366 |
| Molecular Formula | C14H23FIN3 |
| Molecular Weight | 379.26 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | 1-[(3-fluorophenyl)methyl]-2-methyl-3-pentylguanidine;hydroiodide |
| SMILES | CCCCCN/C(=N\C)NCc1cccc(F)c1.I |
| InChI | InChI=1S/C14H22FN3.HI/c1-3-4-5-9-17-14(16-2)18-11-12-7-6-8-13(15)10-12;/h6-8,10H,3-5,9,11H2,1-2H3,(H2,16,17,18);1H |
| InChIKey | HOACSXVWQNRWMR-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.26 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|