C16H35IN4O — CID 111129208
2-methyl-1-(3-methyl-2-morpholin-4-ylbutyl)-3-pentylguanidine;hydroiodide (PubChem CID 111129208) has the molecular formula C16H35IN4O and a molecular weight of 426.39 g/mol. Its IUPAC name is 2-methyl-1-(3-methyl-2-morpholin-4-ylbutyl)-3-pentylguanidine;hydroiodide.
| Compound Name | 2-methyl-1-(3-methyl-2-morpholin-4-ylbutyl)-3-pentylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111129208 |
| Molecular Formula | C16H35IN4O |
| Molecular Weight | 426.39 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | 2-methyl-1-(3-methyl-2-morpholin-4-ylbutyl)-3-pentylguanidine;hydroiodide |
| SMILES | CCCCCN/C(=N\C)NCC(C(C)C)N1CCOCC1.I |
| InChI | InChI=1S/C16H34N4O.HI/c1-5-6-7-8-18-16(17-4)19-13-15(14(2)3)20-9-11-21-12-10-20;/h14-15H,5-13H2,1-4H3,(H2,17,18,19);1H |
| InChIKey | HQXBYFGGJKZMMJ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.39 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|