C14H17F10NO3 — CID 11112922
octan-2-yl 2,2-difluoro-2-(2,2,3,3,5,5,6,6-octafluoromorpholin-4-yl)acetate (PubChem CID 11112922) has the molecular formula C14H17F10NO3 and a molecular weight of 437.27 g/mol. Its IUPAC name is octan-2-yl 2,2-difluoro-2-(2,2,3,3,5,5,6,6-octafluoromorpholin-4-yl)acetate.
| Compound Name | octan-2-yl 2,2-difluoro-2-(2,2,3,3,5,5,6,6-octafluoromorpholin-4-yl)acetate |
|---|---|
| PubChem CID | 11112922 |
| Molecular Formula | C14H17F10NO3 |
| Molecular Weight | 437.27 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | octan-2-yl 2,2-difluoro-2-(2,2,3,3,5,5,6,6-octafluoromorpholin-4-yl)acetate |
| SMILES | CCCCCCC(C)OC(=O)C(F)(F)N1C(F)(F)C(F)(F)OC(F)(F)C1(F)F |
| InChI | InChI=1S/C14H17F10NO3/c1-3-4-5-6-7-8(2)27-9(26)10(15,16)25-11(17,18)13(21,22)28-14(23,24)12(25,19)20/h8H,3-7H2,1-2H3 |
| InChIKey | KHBSOSFOLLTCCF-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.27 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|