C14H25N3O — CID 111129563
1-ethyl-3-[2-(furan-2-yl)ethyl]-2-pentylguanidine (PubChem CID 111129563) has the molecular formula C14H25N3O and a molecular weight of 251.37 g/mol. Its IUPAC name is 1-ethyl-3-[2-(furan-2-yl)ethyl]-2-pentylguanidine.
| Compound Name | 1-ethyl-3-[2-(furan-2-yl)ethyl]-2-pentylguanidine |
|---|---|
| PubChem CID | 111129563 |
| Molecular Formula | C14H25N3O |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.20 |
| IUPAC Name | 1-ethyl-3-[2-(furan-2-yl)ethyl]-2-pentylguanidine |
| SMILES | CCCCC/N=C(\NCC)NCCc1ccco1 |
| InChI | InChI=1S/C14H25N3O/c1-3-5-6-10-16-14(15-4-2)17-11-9-13-8-7-12-18-13/h7-8,12H,3-6,9-11H2,1-2H3,(H2,15,16,17) |
| InChIKey | UXEZLLNXAFXHJO-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 49.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|