C25H40O5Si — CID 11113119
(1R,2S,5aS,9aR,9bR)-4-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-1-(2-methoxyethyl)-8,9a-dimethyl-1,2,3,5,5a,9b-hexahydrocyclopenta[a]naphthalene-6,9-dione (PubChem CID 11113119) has the molecular formula C25H40O5Si and a molecular weight of 448.68 g/mol. Its IUPAC name is (1R,2S,5aS,9aR,9bR)-4-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-1-(2-methoxyethyl)-8,9a-dimethyl-1,2,3,5,5a,9b-hexahydrocyclopenta[a]naphthalene-6,9-dione.
| Compound Name | (1R,2S,5aS,9aR,9bR)-4-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-1-(2-methoxyethyl)-8,9a-dimethyl-1,2,3,5,5a,9b-hexahydrocyclopenta[a]naphthalene-6,9-dione |
|---|---|
| PubChem CID | 11113119 |
| Molecular Formula | C25H40O5Si |
| Molecular Weight | 448.68 g/mol |
| Exact Mass | 448.26 |
| IUPAC Name | (1R,2S,5aS,9aR,9bR)-4-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-1-(2-methoxyethyl)-8,9a-dimethyl-1,2,3,5,5a,9b-hexahydrocyclopenta[a]naphthalene-6,9-dione |
| SMILES | COCC[C@H]1[C@@H](OC)CC2=C(O[Si](C)(C)C(C)(C)C)C[C@@H]3C(=O)C=C(C)C(=O)[C@]3(C)[C@@H]21 |
| InChI | InChI=1S/C25H40O5Si/c1-15-12-19(26)18-14-21(30-31(8,9)24(2,3)4)17-13-20(29-7)16(10-11-28-6)22(17)25(18,5)23(15)27/h12,16,18,20,22H,10-11,13-14H2,1-9H3/t16-,18+,20-,22+,25-/m0/s1 |
| InChIKey | PKPJDIZKOODAEY-REMTXCFJSA-N |
| XLogP | 5.07 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.68 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|