C21H27ClN4O — CID 111131496
N-[3-[[[N-[(4-chlorophenyl)methyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]-2-methylbutanamide (PubChem CID 111131496) has the molecular formula C21H27ClN4O and a molecular weight of 386.93 g/mol. Its IUPAC name is N-[3-[[[N-[(4-chlorophenyl)methyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]-2-methylbutanamide.
| Compound Name | N-[3-[[[N-[(4-chlorophenyl)methyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]-2-methylbutanamide |
|---|---|
| PubChem CID | 111131496 |
| Molecular Formula | C21H27ClN4O |
| Molecular Weight | 386.93 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | N-[3-[[[N-[(4-chlorophenyl)methyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]-2-methylbutanamide |
| SMILES | CCC(C)C(=O)Nc1cccc(CN/C(=N/C)NCc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C21H27ClN4O/c1-4-15(2)20(27)26-19-7-5-6-17(12-19)14-25-21(23-3)24-13-16-8-10-18(22)11-9-16/h5-12,15H,4,13-14H2,1-3H3,(H,26,27)(H2,23,24,25) |
| InChIKey | SPZUZNYSSKJQBB-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.93 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|