C18H23ClIN5O — CID 111131763
N-[2-[[N'-[(4-chlorophenyl)methyl]-N-ethylcarbamimidoyl]amino]ethyl]pyridine-3-carboxamide;hydroiodide (PubChem CID 111131763) has the molecular formula C18H23ClIN5O and a molecular weight of 487.77 g/mol. Its IUPAC name is N-[2-[[N'-[(4-chlorophenyl)methyl]-N-ethylcarbamimidoyl]amino]ethyl]pyridine-3-carboxamide;hydroiodide.
| Compound Name | N-[2-[[N'-[(4-chlorophenyl)methyl]-N-ethylcarbamimidoyl]amino]ethyl]pyridine-3-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111131763 |
| Molecular Formula | C18H23ClIN5O |
| Molecular Weight | 487.77 g/mol |
| Exact Mass | 487.06 |
| IUPAC Name | N-[2-[[N'-[(4-chlorophenyl)methyl]-N-ethylcarbamimidoyl]amino]ethyl]pyridine-3-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(Cl)cc1)NCCNC(=O)c1cccnc1.I |
| InChI | InChI=1S/C18H22ClN5O.HI/c1-2-21-18(24-12-14-5-7-16(19)8-6-14)23-11-10-22-17(25)15-4-3-9-20-13-15;/h3-9,13H,2,10-12H2,1H3,(H,22,25)(H2,21,23,24);1H |
| InChIKey | RWTITRJYEAUEHG-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.77 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|