C26H34N2O5 — CID 11113193
6,7-dimethoxy-2-[1-[3-(4-methoxyphenoxy)propyl]piperidin-3-yl]-3,4-dihydroisoquinolin-1-one (PubChem CID 11113193) has the molecular formula C26H34N2O5 and a molecular weight of 454.57 g/mol. Its IUPAC name is 6,7-dimethoxy-2-[1-[3-(4-methoxyphenoxy)propyl]piperidin-3-yl]-3,4-dihydroisoquinolin-1-one.
| Compound Name | 6,7-dimethoxy-2-[1-[3-(4-methoxyphenoxy)propyl]piperidin-3-yl]-3,4-dihydroisoquinolin-1-one |
|---|---|
| PubChem CID | 11113193 |
| Molecular Formula | C26H34N2O5 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | 6,7-dimethoxy-2-[1-[3-(4-methoxyphenoxy)propyl]piperidin-3-yl]-3,4-dihydroisoquinolin-1-one |
| SMILES | COc1ccc(OCCCN2CCCC(N3CCc4cc(OC)c(OC)cc4C3=O)C2)cc1 |
| InChI | InChI=1S/C26H34N2O5/c1-30-21-7-9-22(10-8-21)33-15-5-13-27-12-4-6-20(18-27)28-14-11-19-16-24(31-2)25(32-3)17-23(19)26(28)29/h7-10,16-17,20H,4-6,11-15,18H2,1-3H3 |
| InChIKey | WHYMKNOBMLCARB-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|