C29H48O2Si — CID 11113242
(1R,2S,4R,5S,6S,7S)-5-[8-[tert-butyl(dimethyl)silyl]oxyoctyl]-4-pent-2-ynyltricyclo[5.2.1.02,6]dec-8-en-3-one (PubChem CID 11113242) has the molecular formula C29H48O2Si and a molecular weight of 456.79 g/mol. Its IUPAC name is (1R,2S,4R,5S,6S,7S)-5-[8-[tert-butyl(dimethyl)silyl]oxyoctyl]-4-pent-2-ynyltricyclo[5.2.1.02,6]dec-8-en-3-one.
| Compound Name | (1R,2S,4R,5S,6S,7S)-5-[8-[tert-butyl(dimethyl)silyl]oxyoctyl]-4-pent-2-ynyltricyclo[5.2.1.02,6]dec-8-en-3-one |
|---|---|
| PubChem CID | 11113242 |
| Molecular Formula | C29H48O2Si |
| Molecular Weight | 456.79 g/mol |
| Exact Mass | 456.34 |
| IUPAC Name | (1R,2S,4R,5S,6S,7S)-5-[8-[tert-butyl(dimethyl)silyl]oxyoctyl]-4-pent-2-ynyltricyclo[5.2.1.02,6]dec-8-en-3-one |
| SMILES | CCC#CC[C@H]1C(=O)[C@@H]2[C@H]([C@@H]1CCCCCCCCO[Si](C)(C)C(C)(C)C)[C@@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C29H48O2Si/c1-7-8-13-17-25-24(26-22-18-19-23(21-22)27(26)28(25)30)16-14-11-9-10-12-15-20-31-32(5,6)29(2,3)4/h18-19,22-27H,7,9-12,14-17,20-21H2,1-6H3/t22-,23+,24-,25-,26+,27+/m1/s1 |
| InChIKey | ACBFQZXSHQFNLA-PXCGUVFGSA-N |
| XLogP | 7.80 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.79 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|