C24H46O5Si2 — CID 11113450
(3S,3aR,6R,6aR,8S,9S,9aS,9bR)-8-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-3,6,9-trimethyl-6-trimethylsilyloxy-4,5,6a,7,8,9,9a,9b-octahydro-3aH-azuleno[4,5-b]furan-2-one (PubChem CID 11113450) has the molecular formula C24H46O5Si2 and a molecular weight of 470.80 g/mol. Its IUPAC name is (3S,3aR,6R,6aR,8S,9S,9aS,9bR)-8-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-3,6,9-trimethyl-6-trimethylsilyloxy-4,5,6a,7,8,9,9a,9b-octahydro-3aH-azuleno[4,5-b]furan-2-one.
| Compound Name | (3S,3aR,6R,6aR,8S,9S,9aS,9bR)-8-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-3,6,9-trimethyl-6-trimethylsilyloxy-4,5,6a,7,8,9,9a,9b-octahydro-3aH-azuleno[4,5-b]furan-2-one |
|---|---|
| PubChem CID | 11113450 |
| Molecular Formula | C24H46O5Si2 |
| Molecular Weight | 470.80 g/mol |
| Exact Mass | 470.29 |
| IUPAC Name | (3S,3aR,6R,6aR,8S,9S,9aS,9bR)-8-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-3,6,9-trimethyl-6-trimethylsilyloxy-4,5,6a,7,8,9,9a,9b-octahydro-3aH-azuleno[4,5-b]furan-2-one |
| SMILES | C[C@H]1[C@@H]2[C@H]3OC(=O)[C@@](C)(O)[C@@H]3CC[C@@](C)(O[Si](C)(C)C)[C@@H]2C[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H46O5Si2/c1-15-18(28-31(10,11)22(2,3)4)14-17-19(15)20-16(24(6,26)21(25)27-20)12-13-23(17,5)29-30(7,8)9/h15-20,26H,12-14H2,1-11H3/t15-,16-,17-,18+,19+,20+,23-,24+/m1/s1 |
| InChIKey | OSNSVTCDDDBHSY-MNOJGTGNSA-N |
| XLogP | 5.35 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.80 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|