C15H13ClN6O6S2 — CID 11113488
2-amino-4-[[4-chloro-6-(4-sulfoanilino)-1,3,5-triazin-2-yl]amino]benzenesulfonic acid (PubChem CID 11113488) has the molecular formula C15H13ClN6O6S2 and a molecular weight of 472.89 g/mol. Its IUPAC name is 2-amino-4-[[4-chloro-6-(4-sulfoanilino)-1,3,5-triazin-2-yl]amino]benzenesulfonic acid.
| Compound Name | 2-amino-4-[[4-chloro-6-(4-sulfoanilino)-1,3,5-triazin-2-yl]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 11113488 |
| Molecular Formula | C15H13ClN6O6S2 |
| Molecular Weight | 472.89 g/mol |
| Exact Mass | 472.00 |
| IUPAC Name | 2-amino-4-[[4-chloro-6-(4-sulfoanilino)-1,3,5-triazin-2-yl]amino]benzenesulfonic acid |
| SMILES | Nc1cc(Nc2nc(Cl)nc(Nc3ccc(S(=O)(=O)O)cc3)n2)ccc1S(=O)(=O)O |
| InChI | InChI=1S/C15H13ClN6O6S2/c16-13-20-14(18-8-1-4-10(5-2-8)29(23,24)25)22-15(21-13)19-9-3-6-12(11(17)7-9)30(26,27)28/h1-7H,17H2,(H,23,24,25)(H,26,27,28)(H2,18,19,20,21,22) |
| InChIKey | RUQNGGRJWIRHFN-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 197.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.89 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|