C22H30F3N3O5 — CID 11113492
(6S,7R,10S)-6-N-hydroxy-7-(2-methylpropyl)-8-oxo-10-N-(2,2,2-trifluoroethyl)-2-oxa-9-azabicyclo[10.2.2]hexadeca-1(14),12,15-triene-6,10-dicarboxamide (PubChem CID 11113492) has the molecular formula C22H30F3N3O5 and a molecular weight of 473.49 g/mol. Its IUPAC name is (6S,7R,10S)-6-N-hydroxy-7-(2-methylpropyl)-8-oxo-10-N-(2,2,2-trifluoroethyl)-2-oxa-9-azabicyclo[10.2.2]hexadeca-1(14),12,15-triene-6,10-dicarboxamide.
| Compound Name | (6S,7R,10S)-6-N-hydroxy-7-(2-methylpropyl)-8-oxo-10-N-(2,2,2-trifluoroethyl)-2-oxa-9-azabicyclo[10.2.2]hexadeca-1(14),12,15-triene-6,10-dicarboxamide |
|---|---|
| PubChem CID | 11113492 |
| Molecular Formula | C22H30F3N3O5 |
| Molecular Weight | 473.49 g/mol |
| Exact Mass | 473.21 |
| IUPAC Name | (6S,7R,10S)-6-N-hydroxy-7-(2-methylpropyl)-8-oxo-10-N-(2,2,2-trifluoroethyl)-2-oxa-9-azabicyclo[10.2.2]hexadeca-1(14),12,15-triene-6,10-dicarboxamide |
| SMILES | CC(C)C[C@H]1C(=O)N[C@H](C(=O)NCC(F)(F)F)Cc2ccc(cc2)OCCC[C@@H]1C(=O)NO |
| InChI | InChI=1S/C22H30F3N3O5/c1-13(2)10-17-16(20(30)28-32)4-3-9-33-15-7-5-14(6-8-15)11-18(27-19(17)29)21(31)26-12-22(23,24)25/h5-8,13,16-18,32H,3-4,9-12H2,1-2H3,(H,26,31)(H,27,29)(H,28,30)/t16-,17+,18-/m0/s1 |
| InChIKey | PNLMWJPYDPWVER-KSZLIROESA-N |
| XLogP | 2.35 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.49 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|