C16H24IN5O — CID 111136120
1-ethyl-2-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]-3-(2-phenylethyl)guanidine;hydroiodide (PubChem CID 111136120) has the molecular formula C16H24IN5O and a molecular weight of 429.31 g/mol. Its IUPAC name is 1-ethyl-2-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]-3-(2-phenylethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]-3-(2-phenylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111136120 |
| Molecular Formula | C16H24IN5O |
| Molecular Weight | 429.31 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | 1-ethyl-2-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]-3-(2-phenylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCc1nc(C)no1)NCCc1ccccc1.I |
| InChI | InChI=1S/C16H23N5O.HI/c1-3-17-16(18-11-9-14-7-5-4-6-8-14)19-12-10-15-20-13(2)21-22-15;/h4-8H,3,9-12H2,1-2H3,(H2,17,18,19);1H |
| InChIKey | WYVIXECIYPBYMP-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 75.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.31 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|