C18H27FN4O2 — CID 111136737
1-[(3-fluoro-4-morpholin-4-ylphenyl)methyl]-2-methyl-3-(oxolan-2-ylmethyl)guanidine (PubChem CID 111136737) has the molecular formula C18H27FN4O2 and a molecular weight of 350.44 g/mol. Its IUPAC name is 1-[(3-fluoro-4-morpholin-4-ylphenyl)methyl]-2-methyl-3-(oxolan-2-ylmethyl)guanidine.
| Compound Name | 1-[(3-fluoro-4-morpholin-4-ylphenyl)methyl]-2-methyl-3-(oxolan-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111136737 |
| Molecular Formula | C18H27FN4O2 |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | 1-[(3-fluoro-4-morpholin-4-ylphenyl)methyl]-2-methyl-3-(oxolan-2-ylmethyl)guanidine |
| SMILES | C/N=C(/NCc1ccc(N2CCOCC2)c(F)c1)NCC1CCCO1 |
| InChI | InChI=1S/C18H27FN4O2/c1-20-18(22-13-15-3-2-8-25-15)21-12-14-4-5-17(16(19)11-14)23-6-9-24-10-7-23/h4-5,11,15H,2-3,6-10,12-13H2,1H3,(H2,20,21,22) |
| InChIKey | OBCQQRWATMTNLL-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|