C19H24N2O9S2 — CID 11113702
[(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(4-methylsulfanyl-2-sulfanylidenepyrimidin-1-yl)oxan-2-yl]methyl acetate (PubChem CID 11113702) has the molecular formula C19H24N2O9S2 and a molecular weight of 488.54 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(4-methylsulfanyl-2-sulfanylidenepyrimidin-1-yl)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(4-methylsulfanyl-2-sulfanylidenepyrimidin-1-yl)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11113702 |
| Molecular Formula | C19H24N2O9S2 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.09 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(4-methylsulfanyl-2-sulfanylidenepyrimidin-1-yl)oxan-2-yl]methyl acetate |
| SMILES | CSc1ccn([C@@H]2O[C@H](COC(C)=O)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OC(C)=O)c(=S)n1 |
| InChI | InChI=1S/C19H24N2O9S2/c1-9(22)26-8-13-15(27-10(2)23)16(28-11(3)24)17(29-12(4)25)18(30-13)21-7-6-14(32-5)20-19(21)31/h6-7,13,15-18H,8H2,1-5H3/t13-,15+,16+,17-,18-/m1/s1 |
| InChIKey | PIKVCKMEKYRVRK-PLLDYVMSSA-N |
| XLogP | 1.59 |
| TPSA | 132.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|