C20H27IN4O2 — CID 111137530
2-methyl-1-(oxolan-2-ylmethyl)-3-[[4-(pyridin-2-ylmethoxy)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111137530) has the molecular formula C20H27IN4O2 and a molecular weight of 482.37 g/mol. Its IUPAC name is 2-methyl-1-(oxolan-2-ylmethyl)-3-[[4-(pyridin-2-ylmethoxy)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-(oxolan-2-ylmethyl)-3-[[4-(pyridin-2-ylmethoxy)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111137530 |
| Molecular Formula | C20H27IN4O2 |
| Molecular Weight | 482.37 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | 2-methyl-1-(oxolan-2-ylmethyl)-3-[[4-(pyridin-2-ylmethoxy)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(OCc2ccccn2)cc1)NCC1CCCO1.I |
| InChI | InChI=1S/C20H26N4O2.HI/c1-21-20(24-14-19-6-4-12-25-19)23-13-16-7-9-18(10-8-16)26-15-17-5-2-3-11-22-17;/h2-3,5,7-11,19H,4,6,12-15H2,1H3,(H2,21,23,24);1H |
| InChIKey | DVWYEZATKSQBQW-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.37 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|