C19H27F2N3O — CID 111138367
1-[[1-(2,6-difluorophenyl)cyclopentyl]methyl]-2-methyl-3-(oxolan-2-ylmethyl)guanidine (PubChem CID 111138367) has the molecular formula C19H27F2N3O and a molecular weight of 351.44 g/mol. Its IUPAC name is 1-[[1-(2,6-difluorophenyl)cyclopentyl]methyl]-2-methyl-3-(oxolan-2-ylmethyl)guanidine.
| Compound Name | 1-[[1-(2,6-difluorophenyl)cyclopentyl]methyl]-2-methyl-3-(oxolan-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111138367 |
| Molecular Formula | C19H27F2N3O |
| Molecular Weight | 351.44 g/mol |
| Exact Mass | 351.21 |
| IUPAC Name | 1-[[1-(2,6-difluorophenyl)cyclopentyl]methyl]-2-methyl-3-(oxolan-2-ylmethyl)guanidine |
| SMILES | C/N=C(\NCC1CCCO1)NCC1(c2c(F)cccc2F)CCCC1 |
| InChI | InChI=1S/C19H27F2N3O/c1-22-18(23-12-14-6-5-11-25-14)24-13-19(9-2-3-10-19)17-15(20)7-4-8-16(17)21/h4,7-8,14H,2-3,5-6,9-13H2,1H3,(H2,22,23,24) |
| InChIKey | RPKUBLNOBXOIPL-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.44 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|