About trans-(1R,2S)-1-ethenyl-2-hept-2-ynyl-1-methylcyclohexane
trans-(1R,2S)-1-ethenyl-2-hept-2-ynyl-1-methylcyclohexane (PubChem CID 11113881) has the molecular formula C16H26
and a molecular weight of 218.38 g/mol. Its IUPAC name is trans-(1R,2S)-1-ethenyl-2-hept-2-ynyl-1-methylcyclohexane.
Molecular Properties
| Compound Name | trans-(1R,2S)-1-ethenyl-2-hept-2-ynyl-1-methylcyclohexane |
| PubChem CID | 11113881 |
| Molecular Formula | C16H26 |
| Molecular Weight | 218.38 g/mol |
| Exact Mass | 218.20 |
| IUPAC Name | trans-(1R,2S)-1-ethenyl-2-hept-2-ynyl-1-methylcyclohexane |
| SMILES | C=C[C@@]1(C)CCCC[C@H]1CC#CCCCC |
| InChI | InChI=1S/C16H26/c1-4-6-7-8-9-12-15-13-10-11-14-16(15,3)5-2/h5,15H,2,4,6-7,10-14H2,1,3H3/t15-,16+/m1/s1 |
| InChIKey | AZZXCAKUFYRNSM-CVEARBPZSA-N |
| XLogP | 4.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.38 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze trans-(1R,2S)-1-ethenyl-2-hept-2-ynyl-1-methylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1R,2S)-1-ethenyl-2-hept-2-ynyl-1-methylcyclohexane?
The IUPAC name of trans-(1R,2S)-1-ethenyl-2-hept-2-ynyl-1-methylcyclohexane (CID 11113881) is trans-(1R,2S)-1-ethenyl-2-hept-2-ynyl-1-methylcyclohexane.
What is the SMILES notation for trans-(1R,2S)-1-ethenyl-2-hept-2-ynyl-1-methylcyclohexane?
The canonical SMILES for trans-(1R,2S)-1-ethenyl-2-hept-2-ynyl-1-methylcyclohexane is C=C[C@@]1(C)CCCC[C@H]1CC#CCCCC.
What is the InChIKey of trans-(1R,2S)-1-ethenyl-2-hept-2-ynyl-1-methylcyclohexane?
The InChIKey is AZZXCAKUFYRNSM-CVEARBPZSA-N. The full InChI is InChI=1S/C16H26/c1-4-6-7-8-9-12-15-13-10-11-14-16(15,3)5-2/h5,15H,2,4,6-7,10-14H2,1,3H3/t15-,16+/m1/s1.
What are the key properties of trans-(1R,2S)-1-ethenyl-2-hept-2-ynyl-1-methylcyclohexane?
trans-(1R,2S)-1-ethenyl-2-hept-2-ynyl-1-methylcyclohexane has a molecular weight of 218.38 g/mol, XLogP of 4.95, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1R,2S)-1-ethenyl-2-hept-2-ynyl-1-methylcyclohexane is sourced from PubChem (CID 11113881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).