C18H26IN5O — CID 111138980
2-methyl-1-(oxolan-2-ylmethyl)-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111138980) has the molecular formula C18H26IN5O and a molecular weight of 455.34 g/mol. Its IUPAC name is 2-methyl-1-(oxolan-2-ylmethyl)-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-(oxolan-2-ylmethyl)-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111138980 |
| Molecular Formula | C18H26IN5O |
| Molecular Weight | 455.34 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | 2-methyl-1-(oxolan-2-ylmethyl)-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccccc1Cn1cccn1)NCC1CCCO1.I |
| InChI | InChI=1S/C18H25N5O.HI/c1-19-18(21-13-17-8-4-11-24-17)20-12-15-6-2-3-7-16(15)14-23-10-5-9-22-23;/h2-3,5-7,9-10,17H,4,8,11-14H2,1H3,(H2,19,20,21);1H |
| InChIKey | FLXKXURPJJKKKO-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.34 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|