C22H38IN5O — CID 111139274
1-ethyl-2-[[4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]methyl]-3-(oxolan-2-ylmethyl)guanidine;hydroiodide (PubChem CID 111139274) has the molecular formula C22H38IN5O and a molecular weight of 515.48 g/mol. Its IUPAC name is 1-ethyl-2-[[4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]methyl]-3-(oxolan-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[[4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]methyl]-3-(oxolan-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111139274 |
| Molecular Formula | C22H38IN5O |
| Molecular Weight | 515.48 g/mol |
| Exact Mass | 515.21 |
| IUPAC Name | 1-ethyl-2-[[4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]methyl]-3-(oxolan-2-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(CN2CCCN(C)CC2)cc1)NCC1CCCO1.I |
| InChI | InChI=1S/C22H37N5O.HI/c1-3-23-22(25-17-21-6-4-15-28-21)24-16-19-7-9-20(10-8-19)18-27-12-5-11-26(2)13-14-27;/h7-10,21H,3-6,11-18H2,1-2H3,(H2,23,24,25);1H |
| InChIKey | DTXTYSJBXPJIMV-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 52.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.48 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|