About 2-(2-methylpropylamino)ethyl 3-aminobenzoate;hydrochloride
2-(2-methylpropylamino)ethyl 3-aminobenzoate;hydrochloride (PubChem CID 11114) has the molecular formula C13H21ClN2O2
and a molecular weight of 272.78 g/mol. Its IUPAC name is 2-(2-methylpropylamino)ethyl 3-aminobenzoate;hydrochloride.
Molecular Properties
| Compound Name | 2-(2-methylpropylamino)ethyl 3-aminobenzoate;hydrochloride |
| PubChem CID | 11114 |
| Molecular Formula | C13H21ClN2O2 |
| Molecular Weight | 272.78 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 2-(2-methylpropylamino)ethyl 3-aminobenzoate;hydrochloride |
| SMILES | CC(C)CNCCOC(=O)c1cccc(N)c1.Cl |
| InChI | InChI=1S/C13H20N2O2.ClH/c1-10(2)9-15-6-7-17-13(16)11-4-3-5-12(14)8-11;/h3-5,8,10,15H,6-7,9,14H2,1-2H3;1H |
| InChIKey | HKUYLJOKQXCBDY-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.78 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-methylpropylamino)ethyl 3-aminobenzoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methylpropylamino)ethyl 3-aminobenzoate;hydrochloride?
The IUPAC name of 2-(2-methylpropylamino)ethyl 3-aminobenzoate;hydrochloride (CID 11114) is 2-(2-methylpropylamino)ethyl 3-aminobenzoate;hydrochloride.
What is the SMILES notation for 2-(2-methylpropylamino)ethyl 3-aminobenzoate;hydrochloride?
The canonical SMILES for 2-(2-methylpropylamino)ethyl 3-aminobenzoate;hydrochloride is CC(C)CNCCOC(=O)c1cccc(N)c1.Cl.
What is the InChIKey of 2-(2-methylpropylamino)ethyl 3-aminobenzoate;hydrochloride?
The InChIKey is HKUYLJOKQXCBDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O2.ClH/c1-10(2)9-15-6-7-17-13(16)11-4-3-5-12(14)8-11;/h3-5,8,10,15H,6-7,9,14H2,1-2H3;1H.
What are the key properties of 2-(2-methylpropylamino)ethyl 3-aminobenzoate;hydrochloride?
2-(2-methylpropylamino)ethyl 3-aminobenzoate;hydrochloride has a molecular weight of 272.78 g/mol, XLogP of 2.09, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methylpropylamino)ethyl 3-aminobenzoate;hydrochloride is sourced from PubChem (CID 11114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).