C23H39IO3Si — CID 11114018
tert-butyl-[(Z,2S,3R,4S)-6-iodo-1-[(4-methoxyphenyl)methoxy]-2,4-dimethylhept-5-en-3-yl]oxy-dimethylsilane (PubChem CID 11114018) has the molecular formula C23H39IO3Si and a molecular weight of 518.55 g/mol. Its IUPAC name is tert-butyl-[(Z,2S,3R,4S)-6-iodo-1-[(4-methoxyphenyl)methoxy]-2,4-dimethylhept-5-en-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(Z,2S,3R,4S)-6-iodo-1-[(4-methoxyphenyl)methoxy]-2,4-dimethylhept-5-en-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 11114018 |
| Molecular Formula | C23H39IO3Si |
| Molecular Weight | 518.55 g/mol |
| Exact Mass | 518.17 |
| IUPAC Name | tert-butyl-[(Z,2S,3R,4S)-6-iodo-1-[(4-methoxyphenyl)methoxy]-2,4-dimethylhept-5-en-3-yl]oxy-dimethylsilane |
| SMILES | COc1ccc(COC[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)/C=C(/C)I)cc1 |
| InChI | InChI=1S/C23H39IO3Si/c1-17(14-19(3)24)22(27-28(8,9)23(4,5)6)18(2)15-26-16-20-10-12-21(25-7)13-11-20/h10-14,17-18,22H,15-16H2,1-9H3/b19-14-/t17-,18-,22+/m0/s1 |
| InChIKey | XYKKVJFSVSMQDI-PJFGYDAISA-N |
| XLogP | 7.21 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.55 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|