C34H40N2O3 — CID 11114079
[(1R,2E,3S)-2-benzylidene-3-(dibenzylamino)cyclopentyl] 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 11114079) has the molecular formula C34H40N2O3 and a molecular weight of 524.71 g/mol. Its IUPAC name is [(1R,2E,3S)-2-benzylidene-3-(dibenzylamino)cyclopentyl] 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | [(1R,2E,3S)-2-benzylidene-3-(dibenzylamino)cyclopentyl] 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 11114079 |
| Molecular Formula | C34H40N2O3 |
| Molecular Weight | 524.71 g/mol |
| Exact Mass | 524.30 |
| IUPAC Name | [(1R,2E,3S)-2-benzylidene-3-(dibenzylamino)cyclopentyl] 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CC1(C)COC(C)(C)N1C(=O)O[C@@H]1CC[C@H](N(Cc2ccccc2)Cc2ccccc2)/C1=C\c1ccccc1 |
| InChI | InChI=1S/C34H40N2O3/c1-33(2)25-38-34(3,4)36(33)32(37)39-31-21-20-30(29(31)22-26-14-8-5-9-15-26)35(23-27-16-10-6-11-17-27)24-28-18-12-7-13-19-28/h5-19,22,30-31H,20-21,23-25H2,1-4H3/b29-22+/t30-,31+/m0/s1 |
| InChIKey | NQTAQPKGJUOJQP-FSVYKAKKSA-N |
| XLogP | 7.29 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.71 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |