C27H50O6Si2 — CID 11114102
[6-[(2R,5S)-1,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methylhept-6-en-2-yl]-5-oxo-2H-pyran-2-yl] acetate (PubChem CID 11114102) has the molecular formula C27H50O6Si2 and a molecular weight of 526.86 g/mol. Its IUPAC name is [6-[(2R,5S)-1,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methylhept-6-en-2-yl]-5-oxo-2H-pyran-2-yl] acetate.
| Compound Name | [6-[(2R,5S)-1,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methylhept-6-en-2-yl]-5-oxo-2H-pyran-2-yl] acetate |
|---|---|
| PubChem CID | 11114102 |
| Molecular Formula | C27H50O6Si2 |
| Molecular Weight | 526.86 g/mol |
| Exact Mass | 526.31 |
| IUPAC Name | [6-[(2R,5S)-1,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methylhept-6-en-2-yl]-5-oxo-2H-pyran-2-yl] acetate |
| SMILES | C=C(C)[C@H](CC[C@H](CO[Si](C)(C)C(C)(C)C)C1OC(OC(C)=O)C=CC1=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H50O6Si2/c1-19(2)23(33-35(12,13)27(7,8)9)16-14-21(18-30-34(10,11)26(4,5)6)25-22(29)15-17-24(32-25)31-20(3)28/h15,17,21,23-25H,1,14,16,18H2,2-13H3/t21-,23+,24?,25?/m1/s1 |
| InChIKey | PZEWLEQQWKOICT-IPMNWIIRSA-N |
| XLogP | 6.78 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.86 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|