C16H18Cl6N2O9 — CID 11114634
[(2R,3S,4R,5R,6R)-3,4-diacetyloxy-5-[(2,2,2-trichloroacetyl)amino]-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate (PubChem CID 11114634) has the molecular formula C16H18Cl6N2O9 and a molecular weight of 595.04 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-3,4-diacetyloxy-5-[(2,2,2-trichloroacetyl)amino]-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6R)-3,4-diacetyloxy-5-[(2,2,2-trichloroacetyl)amino]-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11114634 |
| Molecular Formula | C16H18Cl6N2O9 |
| Molecular Weight | 595.04 g/mol |
| Exact Mass | 591.91 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-3,4-diacetyloxy-5-[(2,2,2-trichloroacetyl)amino]-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate |
| SMILES | [H]/N=C(/O[C@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1NC(=O)C(Cl)(Cl)Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C16H18Cl6N2O9/c1-5(25)29-4-8-10(30-6(2)26)11(31-7(3)27)9(24-14(28)16(20,21)22)12(32-8)33-13(23)15(17,18)19/h8-12,23H,4H2,1-3H3,(H,24,28)/b23-13+/t8-,9-,10-,11-,12-/m1/s1 |
| InChIKey | IRYYFLMRFPICED-MDRPPGSRSA-N |
| XLogP | 2.36 |
| TPSA | 150.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.04 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|