C35H52O3SSi2 — CID 11114717
tert-butyl-dimethyl-[[(3Z,8Z,13E)-5-methyl-4-phenylsulfanyl-14-tri(propan-2-yl)silyloxy-1-oxacyclotetradeca-3,8,13-trien-6,10-diyn-5-yl]oxy]silane (PubChem CID 11114717) has the molecular formula C35H52O3SSi2 and a molecular weight of 609.04 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(3Z,8Z,13E)-5-methyl-4-phenylsulfanyl-14-tri(propan-2-yl)silyloxy-1-oxacyclotetradeca-3,8,13-trien-6,10-diyn-5-yl]oxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(3Z,8Z,13E)-5-methyl-4-phenylsulfanyl-14-tri(propan-2-yl)silyloxy-1-oxacyclotetradeca-3,8,13-trien-6,10-diyn-5-yl]oxy]silane |
|---|---|
| PubChem CID | 11114717 |
| Molecular Formula | C35H52O3SSi2 |
| Molecular Weight | 609.04 g/mol |
| Exact Mass | 608.32 |
| IUPAC Name | tert-butyl-dimethyl-[[(3Z,8Z,13E)-5-methyl-4-phenylsulfanyl-14-tri(propan-2-yl)silyloxy-1-oxacyclotetradeca-3,8,13-trien-6,10-diyn-5-yl]oxy]silane |
| SMILES | CC(C)[Si](O/C1=C/CC#C/C=C\C#CC(C)(O[Si](C)(C)C(C)(C)C)/C(Sc2ccccc2)=C/CO1)(C(C)C)C(C)C |
| InChI | InChI=1S/C35H52O3SSi2/c1-28(2)41(29(3)4,30(5)6)37-33-24-20-15-13-14-16-21-26-35(10,38-40(11,12)34(7,8)9)32(25-27-36-33)39-31-22-18-17-19-23-31/h14,16-19,22-25,28-30H,20,27H2,1-12H3/b16-14-,32-25-,33-24+ |
| InChIKey | LCRWIDKZAQZCFA-LPPNGCJFSA-N |
| XLogP | 10.46 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.04 |
| LogP ≤ 5 | 10.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|