C15H32IN5O — CID 111147172
1-ethyl-3-[2-[ethyl(methyl)amino]ethyl]-2-[3-(2-oxopyrrolidin-1-yl)propyl]guanidine;hydroiodide (PubChem CID 111147172) has the molecular formula C15H32IN5O and a molecular weight of 425.36 g/mol. Its IUPAC name is 1-ethyl-3-[2-[ethyl(methyl)amino]ethyl]-2-[3-(2-oxopyrrolidin-1-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-[ethyl(methyl)amino]ethyl]-2-[3-(2-oxopyrrolidin-1-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111147172 |
| Molecular Formula | C15H32IN5O |
| Molecular Weight | 425.36 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | 1-ethyl-3-[2-[ethyl(methyl)amino]ethyl]-2-[3-(2-oxopyrrolidin-1-yl)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCN1CCCC1=O)NCCN(C)CC.I |
| InChI | InChI=1S/C15H31N5O.HI/c1-4-16-15(18-10-13-19(3)5-2)17-9-7-12-20-11-6-8-14(20)21;/h4-13H2,1-3H3,(H2,16,17,18);1H |
| InChIKey | HQBUKASIJBPCOR-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.36 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|