C21H35IN6O2 — CID 111147592
1-[4-[[[ethylamino-[3-(2-oxopyrrolidin-1-yl)propylamino]methylidene]amino]methyl]phenyl]-3-propan-2-ylurea;hydroiodide (PubChem CID 111147592) has the molecular formula C21H35IN6O2 and a molecular weight of 530.46 g/mol. Its IUPAC name is 1-[4-[[[ethylamino-[3-(2-oxopyrrolidin-1-yl)propylamino]methylidene]amino]methyl]phenyl]-3-propan-2-ylurea;hydroiodide.
| Compound Name | 1-[4-[[[ethylamino-[3-(2-oxopyrrolidin-1-yl)propylamino]methylidene]amino]methyl]phenyl]-3-propan-2-ylurea;hydroiodide |
|---|---|
| PubChem CID | 111147592 |
| Molecular Formula | C21H35IN6O2 |
| Molecular Weight | 530.46 g/mol |
| Exact Mass | 530.19 |
| IUPAC Name | 1-[4-[[[ethylamino-[3-(2-oxopyrrolidin-1-yl)propylamino]methylidene]amino]methyl]phenyl]-3-propan-2-ylurea;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(NC(=O)NC(C)C)cc1)NCCCN1CCCC1=O.I |
| InChI | InChI=1S/C21H34N6O2.HI/c1-4-22-20(23-12-6-14-27-13-5-7-19(27)28)24-15-17-8-10-18(11-9-17)26-21(29)25-16(2)3;/h8-11,16H,4-7,12-15H2,1-3H3,(H2,22,23,24)(H2,25,26,29);1H |
| InChIKey | IPZDUDLPSZTFQM-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 97.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.46 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|