About [3,5-bis[[tert-butyl(diphenyl)silyl]oxy]phenyl]methanol
[3,5-bis[[tert-butyl(diphenyl)silyl]oxy]phenyl]methanol (PubChem CID 11114774) has the molecular formula C39H44O3Si2
and a molecular weight of 616.95 g/mol. Its IUPAC name is [3,5-bis[[tert-butyl(diphenyl)silyl]oxy]phenyl]methanol.
Molecular Properties
| Compound Name | [3,5-bis[[tert-butyl(diphenyl)silyl]oxy]phenyl]methanol |
| PubChem CID | 11114774 |
| Molecular Formula | C39H44O3Si2 |
| Molecular Weight | 616.95 g/mol |
| Exact Mass | 616.28 |
| IUPAC Name | [3,5-bis[[tert-butyl(diphenyl)silyl]oxy]phenyl]methanol |
| SMILES | CC(C)(C)[Si](Oc1cc(CO)cc(O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)c1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C39H44O3Si2/c1-38(2,3)43(34-19-11-7-12-20-34,35-21-13-8-14-22-35)41-32-27-31(30-40)28-33(29-32)42-44(39(4,5)6,36-23-15-9-16-24-36)37-25-17-10-18-26-37/h7-29,40H,30H2,1-6H3 |
| InChIKey | SDDISUZNVYXXHS-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 616.95 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [3,5-bis[[tert-butyl(diphenyl)silyl]oxy]phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,5-bis[[tert-butyl(diphenyl)silyl]oxy]phenyl]methanol?
The IUPAC name of [3,5-bis[[tert-butyl(diphenyl)silyl]oxy]phenyl]methanol (CID 11114774) is [3,5-bis[[tert-butyl(diphenyl)silyl]oxy]phenyl]methanol.
What is the SMILES notation for [3,5-bis[[tert-butyl(diphenyl)silyl]oxy]phenyl]methanol?
The canonical SMILES for [3,5-bis[[tert-butyl(diphenyl)silyl]oxy]phenyl]methanol is CC(C)(C)[Si](Oc1cc(CO)cc(O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)c1)(c1ccccc1)c1ccccc1.
What is the InChIKey of [3,5-bis[[tert-butyl(diphenyl)silyl]oxy]phenyl]methanol?
The InChIKey is SDDISUZNVYXXHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C39H44O3Si2/c1-38(2,3)43(34-19-11-7-12-20-34,35-21-13-8-14-22-35)41-32-27-31(30-40)28-33(29-32)42-44(39(4,5)6,36-23-15-9-16-24-36)37-25-17-10-18-26-37/h7-29,40H,30H2,1-6H3.
What are the key properties of [3,5-bis[[tert-butyl(diphenyl)silyl]oxy]phenyl]methanol?
[3,5-bis[[tert-butyl(diphenyl)silyl]oxy]phenyl]methanol has a molecular weight of 616.95 g/mol, XLogP of 7.06, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3,5-bis[[tert-butyl(diphenyl)silyl]oxy]phenyl]methanol is sourced from PubChem (CID 11114774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).