C30H39NO13 — CID 11114797
benzyl (2R,4R)-2-tert-butyl-5-oxo-4-[[(2R,3S,4R,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]methyl]-1,3-oxazolidine-3-carboxylate (PubChem CID 11114797) has the molecular formula C30H39NO13 and a molecular weight of 621.64 g/mol. Its IUPAC name is benzyl (2R,4R)-2-tert-butyl-5-oxo-4-[[(2R,3S,4R,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]methyl]-1,3-oxazolidine-3-carboxylate.
| Compound Name | benzyl (2R,4R)-2-tert-butyl-5-oxo-4-[[(2R,3S,4R,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]methyl]-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 11114797 |
| Molecular Formula | C30H39NO13 |
| Molecular Weight | 621.64 g/mol |
| Exact Mass | 621.24 |
| IUPAC Name | benzyl (2R,4R)-2-tert-butyl-5-oxo-4-[[(2R,3S,4R,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]methyl]-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(=O)OC[C@H]1O[C@H](C[C@@H]2C(=O)O[C@H](C(C)(C)C)N2C(=O)OCc2ccccc2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C30H39NO13/c1-16(32)38-15-23-25(41-18(3)34)26(42-19(4)35)24(40-17(2)33)22(43-23)13-21-27(36)44-28(30(5,6)7)31(21)29(37)39-14-20-11-9-8-10-12-20/h8-12,21-26,28H,13-15H2,1-7H3/t21-,22-,23-,24+,25-,26-,28-/m1/s1 |
| InChIKey | RULCPEYNCUZKMF-FITCNNEASA-N |
| XLogP | 2.44 |
| TPSA | 170.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.64 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|