C38H42O7S — CID 11114910
[(2R,3R,4S,5R,6S)-6-(2-benzylsulfanylethoxy)-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl acetate (PubChem CID 11114910) has the molecular formula C38H42O7S and a molecular weight of 642.81 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-6-(2-benzylsulfanylethoxy)-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-6-(2-benzylsulfanylethoxy)-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11114910 |
| Molecular Formula | C38H42O7S |
| Molecular Weight | 642.81 g/mol |
| Exact Mass | 642.27 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-6-(2-benzylsulfanylethoxy)-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](OCCSCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C38H42O7S/c1-29(39)41-27-34-35(42-24-30-14-6-2-7-15-30)36(43-25-31-16-8-3-9-17-31)37(44-26-32-18-10-4-11-19-32)38(45-34)40-22-23-46-28-33-20-12-5-13-21-33/h2-21,34-38H,22-28H2,1H3/t34-,35-,36+,37-,38+/m1/s1 |
| InChIKey | VVXPSSXONQNUNI-HRTJLHCRSA-N |
| XLogP | 6.98 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.81 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|