C30H43N7O12S2 — CID 11115351
2-[bis[2-[carboxymethyl-[2-oxo-2-[2-(4-sulfamoylphenyl)ethylamino]ethyl]amino]ethyl]amino]acetic acid (PubChem CID 11115351) has the molecular formula C30H43N7O12S2 and a molecular weight of 757.84 g/mol. Its IUPAC name is 2-[bis[2-[carboxymethyl-[2-oxo-2-[2-(4-sulfamoylphenyl)ethylamino]ethyl]amino]ethyl]amino]acetic acid.
| Compound Name | 2-[bis[2-[carboxymethyl-[2-oxo-2-[2-(4-sulfamoylphenyl)ethylamino]ethyl]amino]ethyl]amino]acetic acid |
|---|---|
| PubChem CID | 11115351 |
| Molecular Formula | C30H43N7O12S2 |
| Molecular Weight | 757.84 g/mol |
| Exact Mass | 757.24 |
| IUPAC Name | 2-[bis[2-[carboxymethyl-[2-oxo-2-[2-(4-sulfamoylphenyl)ethylamino]ethyl]amino]ethyl]amino]acetic acid |
| SMILES | NS(=O)(=O)c1ccc(CCNC(=O)CN(CCN(CCN(CC(=O)O)CC(=O)NCCc2ccc(S(N)(=O)=O)cc2)CC(=O)O)CC(=O)O)cc1 |
| InChI | InChI=1S/C30H43N7O12S2/c31-50(46,47)24-5-1-22(2-6-24)9-11-33-26(38)17-36(20-29(42)43)15-13-35(19-28(40)41)14-16-37(21-30(44)45)18-27(39)34-12-10-23-3-7-25(8-4-23)51(32,48)49/h1-8H,9-21H2,(H,33,38)(H,34,39)(H,40,41)(H,42,43)(H,44,45)(H2,31,46,47)(H2,32,48,49) |
| InChIKey | GTBRQIOYGMBQQS-UHFFFAOYSA-N |
| XLogP | -2.84 |
| TPSA | 300.14 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.84 |
| LogP ≤ 5 | -2.84 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |