C40H60Br2N4O4 — CID 11115490
3-(5-tert-butyl-1,3-dioxoisoindol-2-yl)propyl-[6-[3-(5-tert-butyl-1,3-dioxoisoindol-2-yl)propyl-dimethylazaniumyl]hexyl]-dimethylazanium dibromide (PubChem CID 11115490) has the molecular formula C40H60Br2N4O4 and a molecular weight of 820.75 g/mol. Its IUPAC name is 3-(5-tert-butyl-1,3-dioxoisoindol-2-yl)propyl-[6-[3-(5-tert-butyl-1,3-dioxoisoindol-2-yl)propyl-dimethylazaniumyl]hexyl]-dimethylazanium dibromide.
| Compound Name | 3-(5-tert-butyl-1,3-dioxoisoindol-2-yl)propyl-[6-[3-(5-tert-butyl-1,3-dioxoisoindol-2-yl)propyl-dimethylazaniumyl]hexyl]-dimethylazanium dibromide |
|---|---|
| PubChem CID | 11115490 |
| Molecular Formula | C40H60Br2N4O4 |
| Molecular Weight | 820.75 g/mol |
| Exact Mass | 818.30 |
| IUPAC Name | 3-(5-tert-butyl-1,3-dioxoisoindol-2-yl)propyl-[6-[3-(5-tert-butyl-1,3-dioxoisoindol-2-yl)propyl-dimethylazaniumyl]hexyl]-dimethylazanium dibromide |
| SMILES | CC(C)(C)c1ccc2c(c1)C(=O)N(CCC[N+](C)(C)CCCCCC[N+](C)(C)CCCN1C(=O)c3ccc(C(C)(C)C)cc3C1=O)C2=O.[Br-].[Br-] |
| InChI | InChI=1S/C40H60N4O4.2BrH/c1-39(2,3)29-17-19-31-33(27-29)37(47)41(35(31)45)21-15-25-43(7,8)23-13-11-12-14-24-44(9,10)26-16-22-42-36(46)32-20-18-30(40(4,5)6)28-34(32)38(42)48;;/h17-20,27-28H,11-16,21-26H2,1-10H3;2*1H/q+2;;/p-2 |
| InChIKey | NAHBEEIIDSZQJZ-UHFFFAOYSA-L |
| XLogP | 0.68 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.75 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|