C15H27F3IN3O3 — CID 111155751
ethyl 1-[N'-methyl-N-[3-(2,2,2-trifluoroethoxy)propyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide (PubChem CID 111155751) has the molecular formula C15H27F3IN3O3 and a molecular weight of 481.30 g/mol. Its IUPAC name is ethyl 1-[N'-methyl-N-[3-(2,2,2-trifluoroethoxy)propyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide.
| Compound Name | ethyl 1-[N'-methyl-N-[3-(2,2,2-trifluoroethoxy)propyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111155751 |
| Molecular Formula | C15H27F3IN3O3 |
| Molecular Weight | 481.30 g/mol |
| Exact Mass | 481.10 |
| IUPAC Name | ethyl 1-[N'-methyl-N-[3-(2,2,2-trifluoroethoxy)propyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide |
| SMILES | CCOC(=O)C1CCN(/C(=N/C)NCCCOCC(F)(F)F)CC1.I |
| InChI | InChI=1S/C15H26F3N3O3.HI/c1-3-24-13(22)12-5-8-21(9-6-12)14(19-2)20-7-4-10-23-11-15(16,17)18;/h12H,3-11H2,1-2H3,(H,19,20);1H |
| InChIKey | SRMJDNSADOJPAI-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.30 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|