C29H8F20O2P2 — CID 11115805
[(1R,2R)-2-bis(2,3,4,5,6-pentafluorophenyl)phosphanyloxycyclopentyl]oxy-bis(2,3,4,5,6-pentafluorophenyl)phosphane (PubChem CID 11115805) has the molecular formula C29H8F20O2P2 and a molecular weight of 830.29 g/mol. Its IUPAC name is [(1R,2R)-2-bis(2,3,4,5,6-pentafluorophenyl)phosphanyloxycyclopentyl]oxy-bis(2,3,4,5,6-pentafluorophenyl)phosphane.
| Compound Name | [(1R,2R)-2-bis(2,3,4,5,6-pentafluorophenyl)phosphanyloxycyclopentyl]oxy-bis(2,3,4,5,6-pentafluorophenyl)phosphane |
|---|---|
| PubChem CID | 11115805 |
| Molecular Formula | C29H8F20O2P2 |
| Molecular Weight | 830.29 g/mol |
| Exact Mass | 829.97 |
| IUPAC Name | [(1R,2R)-2-bis(2,3,4,5,6-pentafluorophenyl)phosphanyloxycyclopentyl]oxy-bis(2,3,4,5,6-pentafluorophenyl)phosphane |
| SMILES | Fc1c(F)c(F)c(P(O[C@@H]2CCC[C@H]2OP(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C29H8F20O2P2/c30-6-10(34)18(42)26(19(43)11(6)35)52(27-20(44)12(36)7(31)13(37)21(27)45)50-4-2-1-3-5(4)51-53(28-22(46)14(38)8(32)15(39)23(28)47)29-24(48)16(40)9(33)17(41)25(29)49/h4-5H,1-3H2/t4-,5-/m1/s1 |
| InChIKey | MUHMYZPUIOQGCB-RFZPGFLSSA-N |
| XLogP | 8.82 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 830.29 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|