C16H29IN4O2S — CID 111158410
1-butyl-1,2-dimethyl-3-[2-[(4-methylphenyl)sulfonylamino]ethyl]guanidine;hydroiodide (PubChem CID 111158410) has the molecular formula C16H29IN4O2S and a molecular weight of 468.41 g/mol. Its IUPAC name is 1-butyl-1,2-dimethyl-3-[2-[(4-methylphenyl)sulfonylamino]ethyl]guanidine;hydroiodide.
| Compound Name | 1-butyl-1,2-dimethyl-3-[2-[(4-methylphenyl)sulfonylamino]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111158410 |
| Molecular Formula | C16H29IN4O2S |
| Molecular Weight | 468.41 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | 1-butyl-1,2-dimethyl-3-[2-[(4-methylphenyl)sulfonylamino]ethyl]guanidine;hydroiodide |
| SMILES | CCCCN(C)/C(=N\C)NCCNS(=O)(=O)c1ccc(C)cc1.I |
| InChI | InChI=1S/C16H28N4O2S.HI/c1-5-6-13-20(4)16(17-3)18-11-12-19-23(21,22)15-9-7-14(2)8-10-15;/h7-10,19H,5-6,11-13H2,1-4H3,(H,17,18);1H |
| InChIKey | QWALALLCDHDAHW-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.41 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|