C20H33FIN5O — CID 111158514
1-butyl-3-[3-[4-(4-fluorophenyl)piperazin-1-yl]-3-oxopropyl]-1,2-dimethylguanidine;hydroiodide (PubChem CID 111158514) has the molecular formula C20H33FIN5O and a molecular weight of 505.42 g/mol. Its IUPAC name is 1-butyl-3-[3-[4-(4-fluorophenyl)piperazin-1-yl]-3-oxopropyl]-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 1-butyl-3-[3-[4-(4-fluorophenyl)piperazin-1-yl]-3-oxopropyl]-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111158514 |
| Molecular Formula | C20H33FIN5O |
| Molecular Weight | 505.42 g/mol |
| Exact Mass | 505.17 |
| IUPAC Name | 1-butyl-3-[3-[4-(4-fluorophenyl)piperazin-1-yl]-3-oxopropyl]-1,2-dimethylguanidine;hydroiodide |
| SMILES | CCCCN(C)/C(=N\C)NCCC(=O)N1CCN(c2ccc(F)cc2)CC1.I |
| InChI | InChI=1S/C20H32FN5O.HI/c1-4-5-12-24(3)20(22-2)23-11-10-19(27)26-15-13-25(14-16-26)18-8-6-17(21)7-9-18;/h6-9H,4-5,10-16H2,1-3H3,(H,22,23);1H |
| InChIKey | PLZHRRANWVYHAM-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 51.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.42 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|