C13H29N3 — CID 111158653
1-butyl-3-(3,3-dimethylbutyl)-1,2-dimethylguanidine (PubChem CID 111158653) has the molecular formula C13H29N3 and a molecular weight of 227.40 g/mol. Its IUPAC name is 1-butyl-3-(3,3-dimethylbutyl)-1,2-dimethylguanidine.
| Compound Name | 1-butyl-3-(3,3-dimethylbutyl)-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 111158653 |
| Molecular Formula | C13H29N3 |
| Molecular Weight | 227.40 g/mol |
| Exact Mass | 227.24 |
| IUPAC Name | 1-butyl-3-(3,3-dimethylbutyl)-1,2-dimethylguanidine |
| SMILES | CCCCN(C)/C(=N/C)NCCC(C)(C)C |
| InChI | InChI=1S/C13H29N3/c1-7-8-11-16(6)12(14-5)15-10-9-13(2,3)4/h7-11H2,1-6H3,(H,14,15) |
| InChIKey | ASALHWBJWZFDEY-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.40 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|