C13H26N4O — CID 111159219
N-[2-[(N-butyl-N,N'-dimethylcarbamimidoyl)amino]ethyl]cyclopropanecarboxamide (PubChem CID 111159219) has the molecular formula C13H26N4O and a molecular weight of 254.38 g/mol. Its IUPAC name is N-[2-[(N-butyl-N,N'-dimethylcarbamimidoyl)amino]ethyl]cyclopropanecarboxamide.
| Compound Name | N-[2-[(N-butyl-N,N'-dimethylcarbamimidoyl)amino]ethyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 111159219 |
| Molecular Formula | C13H26N4O |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.21 |
| IUPAC Name | N-[2-[(N-butyl-N,N'-dimethylcarbamimidoyl)amino]ethyl]cyclopropanecarboxamide |
| SMILES | CCCCN(C)/C(=N\C)NCCNC(=O)C1CC1 |
| InChI | InChI=1S/C13H26N4O/c1-4-5-10-17(3)13(14-2)16-9-8-15-12(18)11-6-7-11/h11H,4-10H2,1-3H3,(H,14,16)(H,15,18) |
| InChIKey | UKQNNORTJHHXNG-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|