About aluminum;N,N-dimethylethanamine
aluminum;N,N-dimethylethanamine (PubChem CID 11115999) has the molecular formula C4H11AlN
and a molecular weight of 100.12 g/mol.
Molecular Properties
| Compound Name | aluminum;N,N-dimethylethanamine |
| PubChem CID | 11115999 |
| Molecular Formula | C4H11AlN |
| Molecular Weight | 100.12 g/mol |
| Exact Mass | 100.07 |
| IUPAC Name | — |
| SMILES | CCN(C)C.[Al] |
| InChI | InChI=1S/C4H11N.Al/c1-4-5(2)3;/h4H2,1-3H3; |
| InChIKey | JFULSLYTSZPADJ-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 100.12 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze aluminum;N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aluminum;N,N-dimethylethanamine?
The IUPAC name of aluminum;N,N-dimethylethanamine (CID 11115999) is not available.
What is the SMILES notation for aluminum;N,N-dimethylethanamine?
The canonical SMILES for aluminum;N,N-dimethylethanamine is CCN(C)C.[Al].
What is the InChIKey of aluminum;N,N-dimethylethanamine?
The InChIKey is JFULSLYTSZPADJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11N.Al/c1-4-5(2)3;/h4H2,1-3H3;.
What are the key properties of aluminum;N,N-dimethylethanamine?
aluminum;N,N-dimethylethanamine has a molecular weight of 100.12 g/mol, XLogP of 0.19, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for aluminum;N,N-dimethylethanamine is sourced from PubChem (CID 11115999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).