C17H29N3O — CID 111160557
1-butyl-3-[3-(3-methoxyphenyl)propyl]-1,2-dimethylguanidine (PubChem CID 111160557) has the molecular formula C17H29N3O and a molecular weight of 291.44 g/mol. Its IUPAC name is 1-butyl-3-[3-(3-methoxyphenyl)propyl]-1,2-dimethylguanidine.
| Compound Name | 1-butyl-3-[3-(3-methoxyphenyl)propyl]-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 111160557 |
| Molecular Formula | C17H29N3O |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.23 |
| IUPAC Name | 1-butyl-3-[3-(3-methoxyphenyl)propyl]-1,2-dimethylguanidine |
| SMILES | CCCCN(C)/C(=N\C)NCCCc1cccc(OC)c1 |
| InChI | InChI=1S/C17H29N3O/c1-5-6-13-20(3)17(18-2)19-12-8-10-15-9-7-11-16(14-15)21-4/h7,9,11,14H,5-6,8,10,12-13H2,1-4H3,(H,18,19) |
| InChIKey | IDDXOKGIESOZTC-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|