About (4E)-2,7-dimethylocta-2,4,6-triene
(4E)-2,7-dimethylocta-2,4,6-triene (PubChem CID 11116127) has the molecular formula C10H16
and a molecular weight of 136.24 g/mol. Its IUPAC name is (4E)-2,7-dimethylocta-2,4,6-triene.
Molecular Properties
| Compound Name | (4E)-2,7-dimethylocta-2,4,6-triene |
| PubChem CID | 11116127 |
| Molecular Formula | C10H16 |
| Molecular Weight | 136.24 g/mol |
| Exact Mass | 136.13 |
| IUPAC Name | (4E)-2,7-dimethylocta-2,4,6-triene |
| SMILES | CC(C)=C/C=C/C=C(C)C |
| InChI | InChI=1S/C10H16/c1-9(2)7-5-6-8-10(3)4/h5-8H,1-4H3/b6-5+ |
| InChIKey | UBFBTMRIJJRZOA-AATRIKPKSA-N |
| XLogP | 3.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.24 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4E)-2,7-dimethylocta-2,4,6-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-2,7-dimethylocta-2,4,6-triene?
The IUPAC name of (4E)-2,7-dimethylocta-2,4,6-triene (CID 11116127) is (4E)-2,7-dimethylocta-2,4,6-triene.
What is the SMILES notation for (4E)-2,7-dimethylocta-2,4,6-triene?
The canonical SMILES for (4E)-2,7-dimethylocta-2,4,6-triene is CC(C)=C/C=C/C=C(C)C.
What is the InChIKey of (4E)-2,7-dimethylocta-2,4,6-triene?
The InChIKey is UBFBTMRIJJRZOA-AATRIKPKSA-N. The full InChI is InChI=1S/C10H16/c1-9(2)7-5-6-8-10(3)4/h5-8H,1-4H3/b6-5+.
What are the key properties of (4E)-2,7-dimethylocta-2,4,6-triene?
(4E)-2,7-dimethylocta-2,4,6-triene has a molecular weight of 136.24 g/mol, XLogP of 3.47, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-2,7-dimethylocta-2,4,6-triene is sourced from PubChem (CID 11116127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).