About (5-oxo-2H-pyran-2-yl) acetate
(5-oxo-2H-pyran-2-yl) acetate (PubChem CID 11116290) has the molecular formula C7H8O4
and a molecular weight of 156.14 g/mol. Its IUPAC name is (5-oxo-2H-pyran-2-yl) acetate.
Molecular Properties
| Compound Name | (5-oxo-2H-pyran-2-yl) acetate |
| PubChem CID | 11116290 |
| Molecular Formula | C7H8O4 |
| Molecular Weight | 156.14 g/mol |
| Exact Mass | 156.04 |
| IUPAC Name | (5-oxo-2H-pyran-2-yl) acetate |
| SMILES | CC(=O)OC1C=CC(=O)CO1 |
| InChI | InChI=1S/C7H8O4/c1-5(8)11-7-3-2-6(9)4-10-7/h2-3,7H,4H2,1H3 |
| InChIKey | JJVMFCRCFSJODB-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.14 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5-oxo-2H-pyran-2-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-oxo-2H-pyran-2-yl) acetate?
The IUPAC name of (5-oxo-2H-pyran-2-yl) acetate (CID 11116290) is (5-oxo-2H-pyran-2-yl) acetate.
What is the SMILES notation for (5-oxo-2H-pyran-2-yl) acetate?
The canonical SMILES for (5-oxo-2H-pyran-2-yl) acetate is CC(=O)OC1C=CC(=O)CO1.
What is the InChIKey of (5-oxo-2H-pyran-2-yl) acetate?
The InChIKey is JJVMFCRCFSJODB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O4/c1-5(8)11-7-3-2-6(9)4-10-7/h2-3,7H,4H2,1H3.
What are the key properties of (5-oxo-2H-pyran-2-yl) acetate?
(5-oxo-2H-pyran-2-yl) acetate has a molecular weight of 156.14 g/mol, XLogP of 0.03, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-oxo-2H-pyran-2-yl) acetate is sourced from PubChem (CID 11116290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).