About (4S)-2,2-diethyl-1,3-dioxolane-4-carbaldehyde
(4S)-2,2-diethyl-1,3-dioxolane-4-carbaldehyde (PubChem CID 11116318) has the molecular formula C8H14O3
and a molecular weight of 158.20 g/mol. Its IUPAC name is (4S)-2,2-diethyl-1,3-dioxolane-4-carbaldehyde.
Molecular Properties
| Compound Name | (4S)-2,2-diethyl-1,3-dioxolane-4-carbaldehyde |
| PubChem CID | 11116318 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | (4S)-2,2-diethyl-1,3-dioxolane-4-carbaldehyde |
| SMILES | CCC1(CC)OC[C@@H](C=O)O1 |
| InChI | InChI=1S/C8H14O3/c1-3-8(4-2)10-6-7(5-9)11-8/h5,7H,3-4,6H2,1-2H3/t7-/m1/s1 |
| InChIKey | MQSCFVGTYTZEMA-SSDOTTSWSA-N |
| XLogP | 1.12 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (4S)-2,2-diethyl-1,3-dioxolane-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-2,2-diethyl-1,3-dioxolane-4-carbaldehyde?
The IUPAC name of (4S)-2,2-diethyl-1,3-dioxolane-4-carbaldehyde (CID 11116318) is (4S)-2,2-diethyl-1,3-dioxolane-4-carbaldehyde.
What is the SMILES notation for (4S)-2,2-diethyl-1,3-dioxolane-4-carbaldehyde?
The canonical SMILES for (4S)-2,2-diethyl-1,3-dioxolane-4-carbaldehyde is CCC1(CC)OC[C@@H](C=O)O1.
What is the InChIKey of (4S)-2,2-diethyl-1,3-dioxolane-4-carbaldehyde?
The InChIKey is MQSCFVGTYTZEMA-SSDOTTSWSA-N. The full InChI is InChI=1S/C8H14O3/c1-3-8(4-2)10-6-7(5-9)11-8/h5,7H,3-4,6H2,1-2H3/t7-/m1/s1.
What are the key properties of (4S)-2,2-diethyl-1,3-dioxolane-4-carbaldehyde?
(4S)-2,2-diethyl-1,3-dioxolane-4-carbaldehyde has a molecular weight of 158.20 g/mol, XLogP of 1.12, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-2,2-diethyl-1,3-dioxolane-4-carbaldehyde is sourced from PubChem (CID 11116318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).