About 1-(2,2-difluoroethenyl)cyclohexan-1-ol
1-(2,2-difluoroethenyl)cyclohexan-1-ol (PubChem CID 11116355) has the molecular formula C8H12F2O
and a molecular weight of 162.18 g/mol. Its IUPAC name is 1-(2,2-difluoroethenyl)cyclohexan-1-ol.
Molecular Properties
| Compound Name | 1-(2,2-difluoroethenyl)cyclohexan-1-ol |
| PubChem CID | 11116355 |
| Molecular Formula | C8H12F2O |
| Molecular Weight | 162.18 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | 1-(2,2-difluoroethenyl)cyclohexan-1-ol |
| SMILES | OC1(C=C(F)F)CCCCC1 |
| InChI | InChI=1S/C8H12F2O/c9-7(10)6-8(11)4-2-1-3-5-8/h6,11H,1-5H2 |
| InChIKey | YGJZHBKHKCGMDA-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.18 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(2,2-difluoroethenyl)cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2-difluoroethenyl)cyclohexan-1-ol?
The IUPAC name of 1-(2,2-difluoroethenyl)cyclohexan-1-ol (CID 11116355) is 1-(2,2-difluoroethenyl)cyclohexan-1-ol.
What is the SMILES notation for 1-(2,2-difluoroethenyl)cyclohexan-1-ol?
The canonical SMILES for 1-(2,2-difluoroethenyl)cyclohexan-1-ol is OC1(C=C(F)F)CCCCC1.
What is the InChIKey of 1-(2,2-difluoroethenyl)cyclohexan-1-ol?
The InChIKey is YGJZHBKHKCGMDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12F2O/c9-7(10)6-8(11)4-2-1-3-5-8/h6,11H,1-5H2.
What are the key properties of 1-(2,2-difluoroethenyl)cyclohexan-1-ol?
1-(2,2-difluoroethenyl)cyclohexan-1-ol has a molecular weight of 162.18 g/mol, XLogP of 2.46, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2-difluoroethenyl)cyclohexan-1-ol is sourced from PubChem (CID 11116355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).