About [(1E)-4-methylpenta-1,3-dienyl]cyclohexane
[(1E)-4-methylpenta-1,3-dienyl]cyclohexane (PubChem CID 11116399) has the molecular formula C12H20
and a molecular weight of 164.29 g/mol. Its IUPAC name is [(1E)-4-methylpenta-1,3-dienyl]cyclohexane.
Molecular Properties
| Compound Name | [(1E)-4-methylpenta-1,3-dienyl]cyclohexane |
| PubChem CID | 11116399 |
| Molecular Formula | C12H20 |
| Molecular Weight | 164.29 g/mol |
| Exact Mass | 164.16 |
| IUPAC Name | [(1E)-4-methylpenta-1,3-dienyl]cyclohexane |
| SMILES | CC(C)=C/C=C/C1CCCCC1 |
| InChI | InChI=1S/C12H20/c1-11(2)7-6-10-12-8-4-3-5-9-12/h6-7,10,12H,3-5,8-9H2,1-2H3/b10-6+ |
| InChIKey | MLOXMWMDLHELAO-UXBLZVDNSA-N |
| XLogP | 4.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.29 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(1E)-4-methylpenta-1,3-dienyl]cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1E)-4-methylpenta-1,3-dienyl]cyclohexane?
The IUPAC name of [(1E)-4-methylpenta-1,3-dienyl]cyclohexane (CID 11116399) is [(1E)-4-methylpenta-1,3-dienyl]cyclohexane.
What is the SMILES notation for [(1E)-4-methylpenta-1,3-dienyl]cyclohexane?
The canonical SMILES for [(1E)-4-methylpenta-1,3-dienyl]cyclohexane is CC(C)=C/C=C/C1CCCCC1.
What is the InChIKey of [(1E)-4-methylpenta-1,3-dienyl]cyclohexane?
The InChIKey is MLOXMWMDLHELAO-UXBLZVDNSA-N. The full InChI is InChI=1S/C12H20/c1-11(2)7-6-10-12-8-4-3-5-9-12/h6-7,10,12H,3-5,8-9H2,1-2H3/b10-6+.
What are the key properties of [(1E)-4-methylpenta-1,3-dienyl]cyclohexane?
[(1E)-4-methylpenta-1,3-dienyl]cyclohexane has a molecular weight of 164.29 g/mol, XLogP of 4.09, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(1E)-4-methylpenta-1,3-dienyl]cyclohexane is sourced from PubChem (CID 11116399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).