About 4-amino-2,6-dimethoxyphenol
4-amino-2,6-dimethoxyphenol (PubChem CID 11116461) has the molecular formula C8H11NO3
and a molecular weight of 169.18 g/mol. Its IUPAC name is 4-amino-2,6-dimethoxyphenol.
Molecular Properties
| Compound Name | 4-amino-2,6-dimethoxyphenol |
| PubChem CID | 11116461 |
| Molecular Formula | C8H11NO3 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | 4-amino-2,6-dimethoxyphenol |
| SMILES | COc1cc(N)cc(OC)c1O |
| InChI | InChI=1S/C8H11NO3/c1-11-6-3-5(9)4-7(12-2)8(6)10/h3-4,10H,9H2,1-2H3 |
| InChIKey | PSJZYGKOSQRHPB-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-2,6-dimethoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2,6-dimethoxyphenol?
The IUPAC name of 4-amino-2,6-dimethoxyphenol (CID 11116461) is 4-amino-2,6-dimethoxyphenol.
What is the SMILES notation for 4-amino-2,6-dimethoxyphenol?
The canonical SMILES for 4-amino-2,6-dimethoxyphenol is COc1cc(N)cc(OC)c1O.
What is the InChIKey of 4-amino-2,6-dimethoxyphenol?
The InChIKey is PSJZYGKOSQRHPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO3/c1-11-6-3-5(9)4-7(12-2)8(6)10/h3-4,10H,9H2,1-2H3.
What are the key properties of 4-amino-2,6-dimethoxyphenol?
4-amino-2,6-dimethoxyphenol has a molecular weight of 169.18 g/mol, XLogP of 0.99, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2,6-dimethoxyphenol is sourced from PubChem (CID 11116461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).