C8H17NO3 — CID 11116571
(3R,4R)-4-amino-5-methylideneheptane-1,3,7-triol (PubChem CID 11116571) has the molecular formula C8H17NO3 and a molecular weight of 175.23 g/mol. Its IUPAC name is (3R,4R)-4-amino-5-methylideneheptane-1,3,7-triol.
| Compound Name | (3R,4R)-4-amino-5-methylideneheptane-1,3,7-triol |
|---|---|
| PubChem CID | 11116571 |
| Molecular Formula | C8H17NO3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.12 |
| IUPAC Name | (3R,4R)-4-amino-5-methylideneheptane-1,3,7-triol |
| SMILES | C=C(CCO)[C@@H](N)[C@H](O)CCO |
| InChI | InChI=1S/C8H17NO3/c1-6(2-4-10)8(9)7(12)3-5-11/h7-8,10-12H,1-5,9H2/t7-,8-/m1/s1 |
| InChIKey | NWWSPUWSBOULKY-HTQZYQBOSA-N |
| XLogP | -1.00 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|