C6H8O6 — CID 11116575
(3R,3aR,6S,6aR)-2,3,6-trihydroxy-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-one (PubChem CID 11116575) has the molecular formula C6H8O6 and a molecular weight of 176.12 g/mol. Its IUPAC name is (3R,3aR,6S,6aR)-2,3,6-trihydroxy-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-one.
| Compound Name | (3R,3aR,6S,6aR)-2,3,6-trihydroxy-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-one |
|---|---|
| PubChem CID | 11116575 |
| Molecular Formula | C6H8O6 |
| Molecular Weight | 176.12 g/mol |
| Exact Mass | 176.03 |
| IUPAC Name | (3R,3aR,6S,6aR)-2,3,6-trihydroxy-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-one |
| SMILES | O=C1O[C@H]2[C@H](OC(O)[C@@H]2O)[C@@H]1O |
| InChI | InChI=1S/C6H8O6/c7-1-3-4(12-5(1)9)2(8)6(10)11-3/h1-5,7-9H/t1-,2+,3-,4-,5?/m1/s1 |
| InChIKey | OGLCQHRZUSEXNB-VGASXLIASA-N |
| XLogP | -2.65 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.12 |
| LogP ≤ 5 | -2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |