About S-[2-(1,3-dioxolan-2-yl)ethyl] ethanethioate
S-[2-(1,3-dioxolan-2-yl)ethyl] ethanethioate (PubChem CID 11116580) has the molecular formula C7H12O3S
and a molecular weight of 176.24 g/mol. Its IUPAC name is S-[2-(1,3-dioxolan-2-yl)ethyl] ethanethioate.
Molecular Properties
| Compound Name | S-[2-(1,3-dioxolan-2-yl)ethyl] ethanethioate |
| PubChem CID | 11116580 |
| Molecular Formula | C7H12O3S |
| Molecular Weight | 176.24 g/mol |
| Exact Mass | 176.05 |
| IUPAC Name | S-[2-(1,3-dioxolan-2-yl)ethyl] ethanethioate |
| SMILES | CC(=O)SCCC1OCCO1 |
| InChI | InChI=1S/C7H12O3S/c1-6(8)11-5-2-7-9-3-4-10-7/h7H,2-5H2,1H3 |
| InChIKey | GDHVKVCBLDEQMW-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.24 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[2-(1,3-dioxolan-2-yl)ethyl] ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[2-(1,3-dioxolan-2-yl)ethyl] ethanethioate?
The IUPAC name of S-[2-(1,3-dioxolan-2-yl)ethyl] ethanethioate (CID 11116580) is S-[2-(1,3-dioxolan-2-yl)ethyl] ethanethioate.
What is the SMILES notation for S-[2-(1,3-dioxolan-2-yl)ethyl] ethanethioate?
The canonical SMILES for S-[2-(1,3-dioxolan-2-yl)ethyl] ethanethioate is CC(=O)SCCC1OCCO1.
What is the InChIKey of S-[2-(1,3-dioxolan-2-yl)ethyl] ethanethioate?
The InChIKey is GDHVKVCBLDEQMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O3S/c1-6(8)11-5-2-7-9-3-4-10-7/h7H,2-5H2,1H3.
What are the key properties of S-[2-(1,3-dioxolan-2-yl)ethyl] ethanethioate?
S-[2-(1,3-dioxolan-2-yl)ethyl] ethanethioate has a molecular weight of 176.24 g/mol, XLogP of 1.03, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-[2-(1,3-dioxolan-2-yl)ethyl] ethanethioate is sourced from PubChem (CID 11116580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).